C11H15NO4S — CID 81222893
2-(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-2-methylpropanoic acid (PubChem CID 81222893) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81222893 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-(1-cyclopropyl-2,5-dioxopyrrolidin-3-yl)sulfanyl-2-methylpropanoic acid |
| SMILES | CC(C)(SC1CC(=O)N(C2CC2)C1=O)C(=O)O |
| InChI | InChI=1S/C11H15NO4S/c1-11(2,10(15)16)17-7-5-8(13)12(9(7)14)6-3-4-6/h6-7H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | CBZOJOGZLPNSAW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|