C10H13NO4 — CID 115027264
2-(1-cyclobutyl-2,5-dioxopyrrolidin-3-yl)acetic acid (PubChem CID 115027264) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(1-cyclobutyl-2,5-dioxopyrrolidin-3-yl)acetic acid.
| Compound Name | 2-(1-cyclobutyl-2,5-dioxopyrrolidin-3-yl)acetic acid |
|---|---|
| PubChem CID | 115027264 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(1-cyclobutyl-2,5-dioxopyrrolidin-3-yl)acetic acid |
| SMILES | O=C(O)CC1CC(=O)N(C2CCC2)C1=O |
| InChI | InChI=1S/C10H13NO4/c12-8-4-6(5-9(13)14)10(15)11(8)7-2-1-3-7/h6-7H,1-5H2,(H,13,14) |
| InChIKey | BPPRRQPVUAPCMI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|