C8H16O5S2 — CID 81229258
2-methyl-2-(3-methylsulfonylpropylsulfinyl)propanoic acid (PubChem CID 81229258) has the molecular formula C8H16O5S2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-methyl-2-(3-methylsulfonylpropylsulfinyl)propanoic acid.
| Compound Name | 2-methyl-2-(3-methylsulfonylpropylsulfinyl)propanoic acid |
|---|---|
| PubChem CID | 81229258 |
| Molecular Formula | C8H16O5S2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-methyl-2-(3-methylsulfonylpropylsulfinyl)propanoic acid |
| SMILES | CC(C)(C(=O)O)S(=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C8H16O5S2/c1-8(2,7(9)10)14(11)5-4-6-15(3,12)13/h4-6H2,1-3H3,(H,9,10) |
| InChIKey | PKXNVWGGSPZWFJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |