About 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide
4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide (PubChem CID 81264863) has the molecular formula C15H14F2N2O2
and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide.
Molecular Properties
| Compound Name | 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide |
| PubChem CID | 81264863 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCOc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C15H14F2N2O2/c16-12-2-1-3-13(17)14(12)21-9-8-20-11-6-4-10(5-7-11)15(18)19/h1-7H,8-9H2,(H3,18,19) |
| InChIKey | VZJHXICHWUTKQP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide?
The IUPAC name of 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide (CID 81264863) is 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide.
What is the SMILES notation for 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide?
The canonical SMILES for 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide is [H]/N=C(\N)c1ccc(OCCOc2c(F)cccc2F)cc1.
What is the InChIKey of 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide?
The InChIKey is VZJHXICHWUTKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2O2/c16-12-2-1-3-13(17)14(12)21-9-8-20-11-6-4-10(5-7-11)15(18)19/h1-7H,8-9H2,(H3,18,19).
What are the key properties of 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide?
4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide has a molecular weight of 292.29 g/mol, XLogP of 2.71, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,6-difluorophenoxy)ethoxy]benzenecarboximidamide is sourced from PubChem (CID 81264863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).