C11H11ClFN3 — CID 81266297
3-(3-chloro-2-fluorophenyl)-5-propyl-1H-1,2,4-triazole (PubChem CID 81266297) has the molecular formula C11H11ClFN3 and a molecular weight of 239.68 g/mol. Its IUPAC name is 3-(3-chloro-2-fluorophenyl)-5-propyl-1H-1,2,4-triazole.
| Compound Name | 3-(3-chloro-2-fluorophenyl)-5-propyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 81266297 |
| Molecular Formula | C11H11ClFN3 |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-(3-chloro-2-fluorophenyl)-5-propyl-1H-1,2,4-triazole |
| SMILES | CCCc1nc(-c2cccc(Cl)c2F)n[nH]1 |
| InChI | InChI=1S/C11H11ClFN3/c1-2-4-9-14-11(16-15-9)7-5-3-6-8(12)10(7)13/h3,5-6H,2,4H2,1H3,(H,14,15,16) |
| InChIKey | LKUSWBKPSJDNFE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |