C10H12N2O2S2 — CID 81276418
2-(4-cyano-3-methylphenyl)sulfanylethanesulfonamide (PubChem CID 81276418) has the molecular formula C10H12N2O2S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(4-cyano-3-methylphenyl)sulfanylethanesulfonamide.
| Compound Name | 2-(4-cyano-3-methylphenyl)sulfanylethanesulfonamide |
|---|---|
| PubChem CID | 81276418 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-(4-cyano-3-methylphenyl)sulfanylethanesulfonamide |
| SMILES | Cc1cc(SCCS(N)(=O)=O)ccc1C#N |
| InChI | InChI=1S/C10H12N2O2S2/c1-8-6-10(3-2-9(8)7-11)15-4-5-16(12,13)14/h2-3,6H,4-5H2,1H3,(H2,12,13,14) |
| InChIKey | ZGCKJIUBZTZCJU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |