C9H7F3N2O2S2 — CID 153367368
[2-cyano-5-(trifluoromethylsulfanyl)phenyl]methanesulfonamide (PubChem CID 153367368) has the molecular formula C9H7F3N2O2S2 and a molecular weight of 296.30 g/mol. Its IUPAC name is [2-cyano-5-(trifluoromethylsulfanyl)phenyl]methanesulfonamide.
| Compound Name | [2-cyano-5-(trifluoromethylsulfanyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 153367368 |
| Molecular Formula | C9H7F3N2O2S2 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | [2-cyano-5-(trifluoromethylsulfanyl)phenyl]methanesulfonamide |
| SMILES | N#Cc1ccc(SC(F)(F)F)cc1CS(N)(=O)=O |
| InChI | InChI=1S/C9H7F3N2O2S2/c10-9(11,12)17-8-2-1-6(4-13)7(3-8)5-18(14,15)16/h1-3H,5H2,(H2,14,15,16) |
| InChIKey | SISHLJYJVYXTGR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |