C9H10BrClN2O3S — CID 81291381
4-bromo-3-chloro-N,N-dimethyl-5-sulfamoylbenzamide (PubChem CID 81291381) has the molecular formula C9H10BrClN2O3S and a molecular weight of 341.61 g/mol. Its IUPAC name is 4-bromo-3-chloro-N,N-dimethyl-5-sulfamoylbenzamide.
| Compound Name | 4-bromo-3-chloro-N,N-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 81291381 |
| Molecular Formula | C9H10BrClN2O3S |
| Molecular Weight | 341.61 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | 4-bromo-3-chloro-N,N-dimethyl-5-sulfamoylbenzamide |
| SMILES | CN(C)C(=O)c1cc(Cl)c(Br)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H10BrClN2O3S/c1-13(2)9(14)5-3-6(11)8(10)7(4-5)17(12,15)16/h3-4H,1-2H3,(H2,12,15,16) |
| InChIKey | HDZPQOAEHGMXIF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |