C9H8BrClFNO — CID 177301592
4-bromo-3-chloro-5-fluoro-N,N-dimethylbenzamide (PubChem CID 177301592) has the molecular formula C9H8BrClFNO and a molecular weight of 280.52 g/mol. Its IUPAC name is 4-bromo-3-chloro-5-fluoro-N,N-dimethylbenzamide.
| Compound Name | 4-bromo-3-chloro-5-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 177301592 |
| Molecular Formula | C9H8BrClFNO |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 4-bromo-3-chloro-5-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(F)c(Br)c(Cl)c1 |
| InChI | InChI=1S/C9H8BrClFNO/c1-13(2)9(14)5-3-6(11)8(10)7(12)4-5/h3-4H,1-2H3 |
| InChIKey | ZGQISLKCAOVDLZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|