C10H13FN2O — CID 177300697
4-amino-3-fluoro-N,N,5-trimethylbenzamide (PubChem CID 177300697) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is 4-amino-3-fluoro-N,N,5-trimethylbenzamide.
| Compound Name | 4-amino-3-fluoro-N,N,5-trimethylbenzamide |
|---|---|
| PubChem CID | 177300697 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-amino-3-fluoro-N,N,5-trimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)C)cc(F)c1N |
| InChI | InChI=1S/C10H13FN2O/c1-6-4-7(10(14)13(2)3)5-8(11)9(6)12/h4-5H,12H2,1-3H3 |
| InChIKey | PDFLLJBNLOMNHX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|