About 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane
4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane (PubChem CID 142522795) has the molecular formula C11H17FN2OS
and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane.
Molecular Properties
| Compound Name | 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane |
| PubChem CID | 142522795 |
| Molecular Formula | C11H17FN2OS |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane |
| SMILES | CC.CN(C)C(=O)c1ccc(SN)c(F)c1 |
| InChI | InChI=1S/C9H11FN2OS.C2H6/c1-12(2)9(13)6-3-4-8(14-11)7(10)5-6;1-2/h3-5H,11H2,1-2H3;1-2H3 |
| InChIKey | SHOODDSCYHDAGY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane?
The IUPAC name of 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane (CID 142522795) is 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane.
What is the SMILES notation for 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane?
The canonical SMILES for 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane is CC.CN(C)C(=O)c1ccc(SN)c(F)c1.
What is the InChIKey of 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane?
The InChIKey is SHOODDSCYHDAGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2OS.C2H6/c1-12(2)9(13)6-3-4-8(14-11)7(10)5-6;1-2/h3-5H,11H2,1-2H3;1-2H3.
What are the key properties of 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane?
4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane has a molecular weight of 244.34 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminosulfanyl-3-fluoro-N,N-dimethylbenzamide;ethane is sourced from PubChem (CID 142522795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).