C15H15F2N3O — CID 82991008
3-amino-4-(3,4-difluoroanilino)-N,N-dimethylbenzamide (PubChem CID 82991008) has the molecular formula C15H15F2N3O and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-amino-4-(3,4-difluoroanilino)-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-(3,4-difluoroanilino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82991008 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 3-amino-4-(3,4-difluoroanilino)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Nc2ccc(F)c(F)c2)c(N)c1 |
| InChI | InChI=1S/C15H15F2N3O/c1-20(2)15(21)9-3-6-14(13(18)7-9)19-10-4-5-11(16)12(17)8-10/h3-8,19H,18H2,1-2H3 |
| InChIKey | BXJJBVZXEURNRK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|