C10H11BrFNO — CID 135152216
4-(bromomethyl)-3-fluoro-N,N-dimethylbenzamide (PubChem CID 135152216) has the molecular formula C10H11BrFNO and a molecular weight of 260.11 g/mol. Its IUPAC name is 4-(bromomethyl)-3-fluoro-N,N-dimethylbenzamide.
| Compound Name | 4-(bromomethyl)-3-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 135152216 |
| Molecular Formula | C10H11BrFNO |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4-(bromomethyl)-3-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(CBr)c(F)c1 |
| InChI | InChI=1S/C10H11BrFNO/c1-13(2)10(14)7-3-4-8(6-11)9(12)5-7/h3-5H,6H2,1-2H3 |
| InChIKey | PYIMOUSOKWDWJM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|