C9H8BrFN2O — CID 90879072
N-[amino-[4-(bromomethyl)-3-fluorophenyl]methylidene]formamide (PubChem CID 90879072) has the molecular formula C9H8BrFN2O and a molecular weight of 259.08 g/mol. Its IUPAC name is N-[amino-[4-(bromomethyl)-3-fluorophenyl]methylidene]formamide.
| Compound Name | N-[amino-[4-(bromomethyl)-3-fluorophenyl]methylidene]formamide |
|---|---|
| PubChem CID | 90879072 |
| Molecular Formula | C9H8BrFN2O |
| Molecular Weight | 259.08 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | N-[amino-[4-(bromomethyl)-3-fluorophenyl]methylidene]formamide |
| SMILES | N/C(=N\C=O)c1ccc(CBr)c(F)c1 |
| InChI | InChI=1S/C9H8BrFN2O/c10-4-7-2-1-6(3-8(7)11)9(12)13-5-14/h1-3,5H,4H2,(H2,12,13,14) |
| InChIKey | UJTIZUMVOQTMLD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.08 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|