C13H11F2NO4 — CID 81297311
ethyl 2-fluoro-2-(7-fluoro-5-methyl-2,3-dioxoindol-1-yl)acetate (PubChem CID 81297311) has the molecular formula C13H11F2NO4 and a molecular weight of 283.23 g/mol. Its IUPAC name is ethyl 2-fluoro-2-(7-fluoro-5-methyl-2,3-dioxoindol-1-yl)acetate.
| Compound Name | ethyl 2-fluoro-2-(7-fluoro-5-methyl-2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 81297311 |
| Molecular Formula | C13H11F2NO4 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | ethyl 2-fluoro-2-(7-fluoro-5-methyl-2,3-dioxoindol-1-yl)acetate |
| SMILES | CCOC(=O)C(F)N1C(=O)C(=O)c2cc(C)cc(F)c21 |
| InChI | InChI=1S/C13H11F2NO4/c1-3-20-13(19)11(15)16-9-7(10(17)12(16)18)4-6(2)5-8(9)14/h4-5,11H,3H2,1-2H3 |
| InChIKey | YICZVXOWLLOHMX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|