C13H14N2O2S — CID 81312374
ethyl 2-[2-(5-methyl-2-pyridinyl)-1,3-thiazol-4-yl]acetate (PubChem CID 81312374) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is ethyl 2-[2-(5-methyl-2-pyridinyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(5-methyl-2-pyridinyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 81312374 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethyl 2-[2-(5-methyl-2-pyridinyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(-c2ccc(C)cn2)n1 |
| InChI | InChI=1S/C13H14N2O2S/c1-3-17-12(16)6-10-8-18-13(15-10)11-5-4-9(2)7-14-11/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | MJQRJCYWDVHZEZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |