About quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate
quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate (PubChem CID 81312647) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate.
Molecular Properties
| Compound Name | quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate |
| PubChem CID | 81312647 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate |
| SMILES | Nc1ccc(C(=O)OCc2ccnc3ccccc23)nc1 |
| InChI | InChI=1S/C16H13N3O2/c17-12-5-6-15(19-9-12)16(20)21-10-11-7-8-18-14-4-2-1-3-13(11)14/h1-9H,10,17H2 |
| InChIKey | IWROVAGWRUQVAV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate?
The IUPAC name of quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate (CID 81312647) is quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate.
What is the SMILES notation for quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate?
The canonical SMILES for quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate is Nc1ccc(C(=O)OCc2ccnc3ccccc23)nc1.
What is the InChIKey of quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate?
The InChIKey is IWROVAGWRUQVAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c17-12-5-6-15(19-9-12)16(20)21-10-11-7-8-18-14-4-2-1-3-13(11)14/h1-9H,10,17H2.
What are the key properties of quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate?
quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate has a molecular weight of 279.30 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-4-ylmethyl 5-aminopyridine-2-carboxylate is sourced from PubChem (CID 81312647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).