About quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate
quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate (PubChem CID 127262545) has the molecular formula C15H12N2O2
and a molecular weight of 252.27 g/mol. Its IUPAC name is quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate |
| PubChem CID | 127262545 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate |
| SMILES | O=C(OCc1ccnc2ccccc12)c1cc[nH]c1 |
| InChI | InChI=1S/C15H12N2O2/c18-15(11-5-7-16-9-11)19-10-12-6-8-17-14-4-2-1-3-13(12)14/h1-9,16H,10H2 |
| InChIKey | KARNPOWHMXVNQP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate?
The IUPAC name of quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate (CID 127262545) is quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate.
What is the SMILES notation for quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate?
The canonical SMILES for quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate is O=C(OCc1ccnc2ccccc12)c1cc[nH]c1.
What is the InChIKey of quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate?
The InChIKey is KARNPOWHMXVNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2/c18-15(11-5-7-16-9-11)19-10-12-6-8-17-14-4-2-1-3-13(12)14/h1-9,16H,10H2.
What are the key properties of quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate?
quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate has a molecular weight of 252.27 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-4-ylmethyl 1H-pyrrole-3-carboxylate is sourced from PubChem (CID 127262545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).