C15H24N2O — CID 81322728
[2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]phenyl]methanamine (PubChem CID 81322728) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is [2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]phenyl]methanamine.
| Compound Name | [2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 81322728 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | [2-[2-(2-methyl-1,4-oxazepan-4-yl)ethyl]phenyl]methanamine |
| SMILES | CC1CN(CCc2ccccc2CN)CCCO1 |
| InChI | InChI=1S/C15H24N2O/c1-13-12-17(8-4-10-18-13)9-7-14-5-2-3-6-15(14)11-16/h2-3,5-6,13H,4,7-12,16H2,1H3 |
| InChIKey | HPONCBVPSKBRBU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |