3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride

C10H11BrClFO3S — CID 81326102

IUPAC3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride
SMILESCC(COc1cc(F)cc(Br)c1)CS(=O)(=O)Cl
InChIInChI=1S/C10H11BrClFO3S/c1-7(6-17(12,14)15)5-16-10-3-8(11)2-9(13)4-10/h2-4,7H,5-6H2,1H3
InChIKeyUIMJMPSUCKVAMN-UHFFFAOYSA-N
MW345.62 g/mol
LogP3.17
Rot. Bonds5

About 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride

3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride (PubChem CID 81326102) has the molecular formula C10H11BrClFO3S and a molecular weight of 345.62 g/mol. Its IUPAC name is 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride.

Molecular Properties

Compound Name3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride
PubChem CID81326102
Molecular FormulaC10H11BrClFO3S
Molecular Weight345.62 g/mol
Exact Mass343.93
IUPAC Name3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride
SMILESCC(COc1cc(F)cc(Br)c1)CS(=O)(=O)Cl
InChIInChI=1S/C10H11BrClFO3S/c1-7(6-17(12,14)15)5-16-10-3-8(11)2-9(13)4-10/h2-4,7H,5-6H2,1H3
InChIKeyUIMJMPSUCKVAMN-UHFFFAOYSA-N
XLogP3.17
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500345.62
LogP ≤ 53.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride?
The IUPAC name of 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride (CID 81326102) is 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride.
What is the SMILES notation for 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride?
The canonical SMILES for 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride is CC(COc1cc(F)cc(Br)c1)CS(=O)(=O)Cl.
What is the InChIKey of 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride?
The InChIKey is UIMJMPSUCKVAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrClFO3S/c1-7(6-17(12,14)15)5-16-10-3-8(11)2-9(13)4-10/h2-4,7H,5-6H2,1H3.
What are the key properties of 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride?
3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride has a molecular weight of 345.62 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-5-fluorophenoxy)-2-methylpropane-1-sulfonyl chloride is sourced from PubChem (CID 81326102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).