C7H16N2O3S — CID 81328464
N-(2-aminoethyl)-2-(2-methoxyethylsulfinyl)acetamide (PubChem CID 81328464) has the molecular formula C7H16N2O3S and a molecular weight of 208.28 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(2-methoxyethylsulfinyl)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(2-methoxyethylsulfinyl)acetamide |
|---|---|
| PubChem CID | 81328464 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | N-(2-aminoethyl)-2-(2-methoxyethylsulfinyl)acetamide |
| SMILES | COCCS(=O)CC(=O)NCCN |
| InChI | InChI=1S/C7H16N2O3S/c1-12-4-5-13(11)6-7(10)9-3-2-8/h2-6,8H2,1H3,(H,9,10) |
| InChIKey | UAEJUBSRKGAQOM-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |