C7H10N2O2S — CID 81330066
5-(5-methyloxolan-2-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 81330066) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 5-(5-methyloxolan-2-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(5-methyloxolan-2-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 81330066 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-(5-methyloxolan-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CC1CCC(c2n[nH]c(=S)o2)O1 |
| InChI | InChI=1S/C7H10N2O2S/c1-4-2-3-5(10-4)6-8-9-7(12)11-6/h4-5H,2-3H2,1H3,(H,9,12) |
| InChIKey | AUJYCGPAMCKSPJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|