C7H10N2O3S2 — CID 104520182
5-(1,1-dioxothian-2-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 104520182) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-(1,1-dioxothian-2-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(1,1-dioxothian-2-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 104520182 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 5-(1,1-dioxothian-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | O=S1(=O)CCCCC1c1n[nH]c(=S)o1 |
| InChI | InChI=1S/C7H10N2O3S2/c10-14(11)4-2-1-3-5(14)6-8-9-7(13)12-6/h5H,1-4H2,(H,9,13) |
| InChIKey | RBCYRVZNFQYJDN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|