C15H27N3S — CID 81335905
4-tert-butyl-3-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-imidazole-2-thione (PubChem CID 81335905) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 4-tert-butyl-3-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-imidazole-2-thione.
| Compound Name | 4-tert-butyl-3-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81335905 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-tert-butyl-3-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-imidazole-2-thione |
| SMILES | CC(C)N1CCC(Cn2c(C(C)(C)C)c[nH]c2=S)C1 |
| InChI | InChI=1S/C15H27N3S/c1-11(2)17-7-6-12(9-17)10-18-13(15(3,4)5)8-16-14(18)19/h8,11-12H,6-7,9-10H2,1-5H3,(H,16,19) |
| InChIKey | NAKKBZPOBXFNDY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|