C13H18N2S2 — CID 81336128
4-ethyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione (PubChem CID 81336128) has the molecular formula C13H18N2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 4-ethyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione.
| Compound Name | 4-ethyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81336128 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-ethyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione |
| SMILES | CCCC(c1cccs1)n1c(CC)c[nH]c1=S |
| InChI | InChI=1S/C13H18N2S2/c1-3-6-11(12-7-5-8-17-12)15-10(4-2)9-14-13(15)16/h5,7-9,11H,3-4,6H2,1-2H3,(H,14,16) |
| InChIKey | GGHTZUYWSRPXPS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|