C17H18N2S2 — CID 63548855
4-phenyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione (PubChem CID 63548855) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 4-phenyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione.
| Compound Name | 4-phenyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 63548855 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-phenyl-3-(1-thiophen-2-ylbutyl)-1H-imidazole-2-thione |
| SMILES | CCCC(c1cccs1)n1c(-c2ccccc2)c[nH]c1=S |
| InChI | InChI=1S/C17H18N2S2/c1-2-7-14(16-10-6-11-21-16)19-15(12-18-17(19)20)13-8-4-3-5-9-13/h3-6,8-12,14H,2,7H2,1H3,(H,18,20) |
| InChIKey | VXVBIYOEMSKDJX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|