C12H13N3O2S2 — CID 81340368
1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazole-4-sulfonamide (PubChem CID 81340368) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 81340368 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)pyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cnn(CC2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C12H13N3O2S2/c13-19(16,17)11-6-14-15(8-11)7-10-5-9-3-1-2-4-12(9)18-10/h1-4,6,8,10H,5,7H2,(H2,13,16,17) |
| InChIKey | FQQFHBHUHJOIAF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |