C7H10F3N3O3S — CID 81340845
1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazole-4-sulfonamide (PubChem CID 81340845) has the molecular formula C7H10F3N3O3S and a molecular weight of 273.24 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazole-4-sulfonamide.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 81340845 |
| Molecular Formula | C7H10F3N3O3S |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cn(CCOCC(F)(F)F)cn1 |
| InChI | InChI=1S/C7H10F3N3O3S/c8-7(9,10)4-16-2-1-13-3-6(12-5-13)17(11,14)15/h3,5H,1-2,4H2,(H2,11,14,15) |
| InChIKey | MDKSYBYSKQRIGW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|