C14H17N3O3 — CID 81341337
methyl 2-amino-5-(2,5-dimethylpyrazol-3-yl)oxy-3-methylbenzoate (PubChem CID 81341337) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is methyl 2-amino-5-(2,5-dimethylpyrazol-3-yl)oxy-3-methylbenzoate.
| Compound Name | methyl 2-amino-5-(2,5-dimethylpyrazol-3-yl)oxy-3-methylbenzoate |
|---|---|
| PubChem CID | 81341337 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | methyl 2-amino-5-(2,5-dimethylpyrazol-3-yl)oxy-3-methylbenzoate |
| SMILES | COC(=O)c1cc(Oc2cc(C)nn2C)cc(C)c1N |
| InChI | InChI=1S/C14H17N3O3/c1-8-5-10(7-11(13(8)15)14(18)19-4)20-12-6-9(2)16-17(12)3/h5-7H,15H2,1-4H3 |
| InChIKey | HQAKNJLBJXINSX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|