C15H20N2O2S2 — CID 81344882
2-[5-tert-butyl-1-[(4-methylthiophen-3-yl)methyl]imidazol-2-yl]sulfanylacetic acid (PubChem CID 81344882) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-[5-tert-butyl-1-[(4-methylthiophen-3-yl)methyl]imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-tert-butyl-1-[(4-methylthiophen-3-yl)methyl]imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81344882 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[5-tert-butyl-1-[(4-methylthiophen-3-yl)methyl]imidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1cscc1Cn1c(C(C)(C)C)cnc1SCC(=O)O |
| InChI | InChI=1S/C15H20N2O2S2/c1-10-7-20-8-11(10)6-17-12(15(2,3)4)5-16-14(17)21-9-13(18)19/h5,7-8H,6,9H2,1-4H3,(H,18,19) |
| InChIKey | ITVYUWLFLHZSJW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |