C8H15N3O — CID 81346017
3-(2,5-dimethylpyrazol-3-yl)oxypropan-1-amine (PubChem CID 81346017) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrazol-3-yl)oxypropan-1-amine.
| Compound Name | 3-(2,5-dimethylpyrazol-3-yl)oxypropan-1-amine |
|---|---|
| PubChem CID | 81346017 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-(2,5-dimethylpyrazol-3-yl)oxypropan-1-amine |
| SMILES | Cc1cc(OCCCN)n(C)n1 |
| InChI | InChI=1S/C8H15N3O/c1-7-6-8(11(2)10-7)12-5-3-4-9/h6H,3-5,9H2,1-2H3 |
| InChIKey | RAOQMNAYDHVOTA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|