C13H15BrO — CID 81351637
2'-(bromomethyl)-5-methoxyspiro[1,2-dihydroindene-3,1'-cyclopropane] (PubChem CID 81351637) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is 2'-(bromomethyl)-5-methoxyspiro[1,2-dihydroindene-3,1'-cyclopropane].
| Compound Name | 2'-(bromomethyl)-5-methoxyspiro[1,2-dihydroindene-3,1'-cyclopropane] |
|---|---|
| PubChem CID | 81351637 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2'-(bromomethyl)-5-methoxyspiro[1,2-dihydroindene-3,1'-cyclopropane] |
| SMILES | COc1ccc2c(c1)C1(CC2)CC1CBr |
| InChI | InChI=1S/C13H15BrO/c1-15-11-3-2-9-4-5-13(12(9)6-11)7-10(13)8-14/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | INTBCRSJOXMMFN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|