About 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene
1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene (PubChem CID 81357701) has the molecular formula C11H11BrF2
and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene |
| PubChem CID | 81357701 |
| Molecular Formula | C11H11BrF2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene |
| SMILES | CC1(c2ccc(F)cc2F)CC1CBr |
| InChI | InChI=1S/C11H11BrF2/c1-11(5-7(11)6-12)9-3-2-8(13)4-10(9)14/h2-4,7H,5-6H2,1H3 |
| InChIKey | CQHHUPPQEUQHOZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene?
The IUPAC name of 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene (CID 81357701) is 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene.
What is the SMILES notation for 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene?
The canonical SMILES for 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene is CC1(c2ccc(F)cc2F)CC1CBr.
What is the InChIKey of 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene?
The InChIKey is CQHHUPPQEUQHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2/c1-11(5-7(11)6-12)9-3-2-8(13)4-10(9)14/h2-4,7H,5-6H2,1H3.
What are the key properties of 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene?
1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene has a molecular weight of 261.11 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(bromomethyl)-1-methylcyclopropyl]-2,4-difluorobenzene is sourced from PubChem (CID 81357701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).