C10H17FO3 — CID 81357963
2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)acetic acid (PubChem CID 81357963) has the molecular formula C10H17FO3 and a molecular weight of 204.24 g/mol. Its IUPAC name is 2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)acetic acid.
| Compound Name | 2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)acetic acid |
|---|---|
| PubChem CID | 81357963 |
| Molecular Formula | C10H17FO3 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)acetic acid |
| SMILES | CC1(C)CC(C(F)C(=O)O)C(C)(C)O1 |
| InChI | InChI=1S/C10H17FO3/c1-9(2)5-6(7(11)8(12)13)10(3,4)14-9/h6-7H,5H2,1-4H3,(H,12,13) |
| InChIKey | DXMGVLDJXFPZDG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |