C17H22N2O2 — CID 81391853
(1R)-1-(furan-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]ethanamine (PubChem CID 81391853) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (1R)-1-(furan-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(furan-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81391853 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1R)-1-(furan-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc(N2CCOCC2)cc1)c1ccco1 |
| InChI | InChI=1S/C17H22N2O2/c1-14(17-3-2-10-21-17)18-13-15-4-6-16(7-5-15)19-8-11-20-12-9-19/h2-7,10,14,18H,8-9,11-13H2,1H3/t14-/m1/s1 |
| InChIKey | JZLRDFCHQWFLMA-CQSZACIVSA-N |
| XLogP | 2.97 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|