C12H20N2 — CID 81396209
(1R)-1-cyclopentyl-N-(1H-pyrrol-2-ylmethyl)ethanamine (PubChem CID 81396209) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (1R)-1-cyclopentyl-N-(1H-pyrrol-2-ylmethyl)ethanamine.
| Compound Name | (1R)-1-cyclopentyl-N-(1H-pyrrol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 81396209 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (1R)-1-cyclopentyl-N-(1H-pyrrol-2-ylmethyl)ethanamine |
| SMILES | C[C@@H](NCc1ccc[nH]1)C1CCCC1 |
| InChI | InChI=1S/C12H20N2/c1-10(11-5-2-3-6-11)14-9-12-7-4-8-13-12/h4,7-8,10-11,13-14H,2-3,5-6,9H2,1H3/t10-/m1/s1 |
| InChIKey | ZFFBXOMEGDUOKV-SNVBAGLBSA-N |
| XLogP | 2.68 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |