C14H19F3N2 — CID 81405721
N-[(1S)-1-pyridin-4-ylethyl]-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 81405721) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-[(1S)-1-pyridin-4-ylethyl]-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(1S)-1-pyridin-4-ylethyl]-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 81405721 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[(1S)-1-pyridin-4-ylethyl]-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | C[C@H](NC1CCCC(C(F)(F)F)C1)c1ccncc1 |
| InChI | InChI=1S/C14H19F3N2/c1-10(11-5-7-18-8-6-11)19-13-4-2-3-12(9-13)14(15,16)17/h5-8,10,12-13,19H,2-4,9H2,1H3/t10-,12?,13?/m0/s1 |
| InChIKey | KSGSMZSSTOMERD-PKSQDBQZSA-N |
| XLogP | 3.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |