C15H23BrClNO2 — CID 81412513
2-[(3-bromo-5-chloro-2-ethoxyanilino)methyl]-2-ethylbutan-1-ol (PubChem CID 81412513) has the molecular formula C15H23BrClNO2 and a molecular weight of 364.71 g/mol. Its IUPAC name is 2-[(3-bromo-5-chloro-2-ethoxyanilino)methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[(3-bromo-5-chloro-2-ethoxyanilino)methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 81412513 |
| Molecular Formula | C15H23BrClNO2 |
| Molecular Weight | 364.71 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-[(3-bromo-5-chloro-2-ethoxyanilino)methyl]-2-ethylbutan-1-ol |
| SMILES | CCOc1c(Br)cc(Cl)cc1NCC(CC)(CC)CO |
| InChI | InChI=1S/C15H23BrClNO2/c1-4-15(5-2,10-19)9-18-13-8-11(17)7-12(16)14(13)20-6-3/h7-8,18-19H,4-6,9-10H2,1-3H3 |
| InChIKey | VBKSDWKQDLNOQA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.71 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |