C16H20N2O2 — CID 81427887
N-(1,3-dioxan-4-ylmethyl)-2-quinolin-8-ylethanamine (PubChem CID 81427887) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-2-quinolin-8-ylethanamine.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-2-quinolin-8-ylethanamine |
|---|---|
| PubChem CID | 81427887 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-2-quinolin-8-ylethanamine |
| SMILES | c1cnc2c(CCNCC3CCOCO3)cccc2c1 |
| InChI | InChI=1S/C16H20N2O2/c1-3-13-5-2-8-18-16(13)14(4-1)6-9-17-11-15-7-10-19-12-20-15/h1-5,8,15,17H,6-7,9-12H2 |
| InChIKey | NLXIWEHLLKQSSC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|