C12H12ClF2NO — CID 81429076
N-[(E)-4-chlorobut-2-enyl]-2-(2,4-difluorophenyl)acetamide (PubChem CID 81429076) has the molecular formula C12H12ClF2NO and a molecular weight of 259.68 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-2-(2,4-difluorophenyl)acetamide.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-2-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 81429076 |
| Molecular Formula | C12H12ClF2NO |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-2-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1F)NC/C=C/CCl |
| InChI | InChI=1S/C12H12ClF2NO/c13-5-1-2-6-16-12(17)7-9-3-4-10(14)8-11(9)15/h1-4,8H,5-7H2,(H,16,17)/b2-1+ |
| InChIKey | AICKGKULUAISNP-OWOJBTEDSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|