C13H14ClF2NO2 — CID 58478304
4-chloro-N-[3-(2,4-difluorophenyl)-2-oxopropyl]butanamide (PubChem CID 58478304) has the molecular formula C13H14ClF2NO2 and a molecular weight of 289.71 g/mol. Its IUPAC name is 4-chloro-N-[3-(2,4-difluorophenyl)-2-oxopropyl]butanamide.
| Compound Name | 4-chloro-N-[3-(2,4-difluorophenyl)-2-oxopropyl]butanamide |
|---|---|
| PubChem CID | 58478304 |
| Molecular Formula | C13H14ClF2NO2 |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-chloro-N-[3-(2,4-difluorophenyl)-2-oxopropyl]butanamide |
| SMILES | O=C(CNC(=O)CCCCl)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H14ClF2NO2/c14-5-1-2-13(19)17-8-11(18)6-9-3-4-10(15)7-12(9)16/h3-4,7H,1-2,5-6,8H2,(H,17,19) |
| InChIKey | GBZLKMUNPOBNBA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|