C14H11FN2O — CID 81431671
2-[(4-fluorophenyl)methyl]-3H-benzimidazol-5-ol (PubChem CID 81431671) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3H-benzimidazol-5-ol.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3H-benzimidazol-5-ol |
|---|---|
| PubChem CID | 81431671 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3H-benzimidazol-5-ol |
| SMILES | Oc1ccc2nc(Cc3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C14H11FN2O/c15-10-3-1-9(2-4-10)7-14-16-12-6-5-11(18)8-13(12)17-14/h1-6,8,18H,7H2,(H,16,17) |
| InChIKey | CQHIGGSJOOLOCB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |