C12H16FNO3S2 — CID 81435732
(2-fluoro-3-methyl-5-thiomorpholin-4-ylsulfonylphenyl)methanol (PubChem CID 81435732) has the molecular formula C12H16FNO3S2 and a molecular weight of 305.40 g/mol. Its IUPAC name is (2-fluoro-3-methyl-5-thiomorpholin-4-ylsulfonylphenyl)methanol.
| Compound Name | (2-fluoro-3-methyl-5-thiomorpholin-4-ylsulfonylphenyl)methanol |
|---|---|
| PubChem CID | 81435732 |
| Molecular Formula | C12H16FNO3S2 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (2-fluoro-3-methyl-5-thiomorpholin-4-ylsulfonylphenyl)methanol |
| SMILES | Cc1cc(S(=O)(=O)N2CCSCC2)cc(CO)c1F |
| InChI | InChI=1S/C12H16FNO3S2/c1-9-6-11(7-10(8-15)12(9)13)19(16,17)14-2-4-18-5-3-14/h6-7,15H,2-5,8H2,1H3 |
| InChIKey | PMOGPZYPKCTVOB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |