C11H10N4O5 — CID 81438582
6-[(3-methyl-1,2-oxazol-5-yl)methylamino]-5-nitropyridine-3-carboxylic acid (PubChem CID 81438582) has the molecular formula C11H10N4O5 and a molecular weight of 278.22 g/mol. Its IUPAC name is 6-[(3-methyl-1,2-oxazol-5-yl)methylamino]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 6-[(3-methyl-1,2-oxazol-5-yl)methylamino]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81438582 |
| Molecular Formula | C11H10N4O5 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 6-[(3-methyl-1,2-oxazol-5-yl)methylamino]-5-nitropyridine-3-carboxylic acid |
| SMILES | Cc1cc(CNc2ncc(C(=O)O)cc2[N+](=O)[O-])on1 |
| InChI | InChI=1S/C11H10N4O5/c1-6-2-8(20-14-6)5-13-10-9(15(18)19)3-7(4-12-10)11(16)17/h2-4H,5H2,1H3,(H,12,13)(H,16,17) |
| InChIKey | WALDDKHLNPEEFZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|