C13H14Cl2N4O2 — CID 81444507
N-(2,6-dichlorophenyl)-3-[4-(1-hydroxyethyl)triazol-1-yl]propanamide (PubChem CID 81444507) has the molecular formula C13H14Cl2N4O2 and a molecular weight of 329.19 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3-[4-(1-hydroxyethyl)triazol-1-yl]propanamide.
| Compound Name | N-(2,6-dichlorophenyl)-3-[4-(1-hydroxyethyl)triazol-1-yl]propanamide |
|---|---|
| PubChem CID | 81444507 |
| Molecular Formula | C13H14Cl2N4O2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3-[4-(1-hydroxyethyl)triazol-1-yl]propanamide |
| SMILES | CC(O)c1cn(CCC(=O)Nc2c(Cl)cccc2Cl)nn1 |
| InChI | InChI=1S/C13H14Cl2N4O2/c1-8(20)11-7-19(18-17-11)6-5-12(21)16-13-9(14)3-2-4-10(13)15/h2-4,7-8,20H,5-6H2,1H3,(H,16,21) |
| InChIKey | GNAUZHZAZYEOMA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |