C11H18ClN5 — CID 81470286
5-chloro-4-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-2-amine (PubChem CID 81470286) has the molecular formula C11H18ClN5 and a molecular weight of 255.75 g/mol. Its IUPAC name is 5-chloro-4-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-4-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 81470286 |
| Molecular Formula | C11H18ClN5 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 5-chloro-4-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]pyrimidin-2-amine |
| SMILES | CC1CN(c2nc(N)ncc2Cl)CC1N(C)C |
| InChI | InChI=1S/C11H18ClN5/c1-7-5-17(6-9(7)16(2)3)10-8(12)4-14-11(13)15-10/h4,7,9H,5-6H2,1-3H3,(H2,13,14,15) |
| InChIKey | QOKVTDFNYWTHET-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |