C13H18Cl2N4O — CID 814898
2,2-dichloro-1-[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]ethanone (PubChem CID 814898) has the molecular formula C13H18Cl2N4O and a molecular weight of 317.22 g/mol. Its IUPAC name is 2,2-dichloro-1-[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 814898 |
| Molecular Formula | C13H18Cl2N4O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2,2-dichloro-1-[4-(2,5,6-trimethylpyrimidin-4-yl)piperazin-1-yl]ethanone |
| SMILES | Cc1nc(C)c(C)c(N2CCN(C(=O)C(Cl)Cl)CC2)n1 |
| InChI | InChI=1S/C13H18Cl2N4O/c1-8-9(2)16-10(3)17-12(8)18-4-6-19(7-5-18)13(20)11(14)15/h11H,4-7H2,1-3H3 |
| InChIKey | SENWHQBETPVWFR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|