C15H18N4OS — CID 818161
N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-piperidin-1-ylacetamide (PubChem CID 818161) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-piperidin-1-ylacetamide.
| Compound Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 818161 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)-2-piperidin-1-ylacetamide |
| SMILES | O=C(CN1CCCCC1)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H18N4OS/c20-13(11-19-9-5-2-6-10-19)16-15-18-17-14(21-15)12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H,16,18,20) |
| InChIKey | VFPVKGXEGPWSBE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |