C11H20F2N2 — CID 81930981
1-[(4,4-Difluorocyclohexyl)methyl]piperazine (PubChem CID 81930981) has the molecular formula C11H20F2N2 and a molecular weight of 218.29 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]piperazine.
| Compound Name | 1-[(4,4-Difluorocyclohexyl)methyl]piperazine |
|---|---|
| PubChem CID | 81930981 |
| Molecular Formula | C11H20F2N2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]piperazine |
| SMILES | C1CC(CCC1CN2CCNCC2)(F)F |
| InChI | InChI=1S/C11H20F2N2/c12-11(13)3-1-10(2-4-11)9-15-7-5-14-6-8-15/h10,14H,1-9H2 |
| InChIKey | FNYSMVRBQPWSEI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 15.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 193 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |