C8H8ClF2NO — CID 82005069
4-chloro-2-(2,2-difluoroethoxymethyl)pyridine (PubChem CID 82005069) has the molecular formula C8H8ClF2NO and a molecular weight of 207.61 g/mol. Its IUPAC name is 4-chloro-2-(2,2-difluoroethoxymethyl)pyridine.
| Compound Name | 4-chloro-2-(2,2-difluoroethoxymethyl)pyridine |
|---|---|
| PubChem CID | 82005069 |
| Molecular Formula | C8H8ClF2NO |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 4-chloro-2-(2,2-difluoroethoxymethyl)pyridine |
| SMILES | FC(F)COCc1cc(Cl)ccn1 |
| InChI | InChI=1S/C8H8ClF2NO/c9-6-1-2-12-7(3-6)4-13-5-8(10)11/h1-3,8H,4-5H2 |
| InChIKey | WXMUDEVLIICVMS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |